C25H32N4O2S — CID 40602230
1-[3-(dimethylamino)propyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-[(1S)-1-phenylethyl]thiourea (PubChem CID 40602230) has the molecular formula C25H32N4O2S and a molecular weight of 452.62 g/mol. Its IUPAC name is 1-[3-(dimethylamino)propyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-[(1S)-1-phenylethyl]thiourea.
| Compound Name | 1-[3-(dimethylamino)propyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-[(1S)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 40602230 |
| Molecular Formula | C25H32N4O2S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 1-[3-(dimethylamino)propyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-[(1S)-1-phenylethyl]thiourea |
| SMILES | COc1ccc2cc(CN(CCCN(C)C)C(=S)N[C@@H](C)c3ccccc3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C25H32N4O2S/c1-18(19-9-6-5-7-10-19)26-25(32)29(14-8-13-28(2)3)17-21-15-20-11-12-22(31-4)16-23(20)27-24(21)30/h5-7,9-12,15-16,18H,8,13-14,17H2,1-4H3,(H,26,32)(H,27,30)/t18-/m0/s1 |
| InChIKey | MJMRTEGRRGUBDH-SFHVURJKSA-N |
| XLogP | 3.93 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|