C21H33N4O2S+ — CID 7116751
3-[[(2R)-butan-2-yl]carbamothioyl-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]amino]propyl-dimethylazanium (PubChem CID 7116751) has the molecular formula C21H33N4O2S+ and a molecular weight of 405.59 g/mol. Its IUPAC name is 3-[[(2R)-butan-2-yl]carbamothioyl-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[[(2R)-butan-2-yl]carbamothioyl-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7116751 |
| Molecular Formula | C21H33N4O2S+ |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 3-[[(2R)-butan-2-yl]carbamothioyl-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]amino]propyl-dimethylazanium |
| SMILES | CC[C@@H](C)NC(=S)N(CCC[NH+](C)C)Cc1cc2ccc(OC)cc2[nH]c1=O |
| InChI | InChI=1S/C21H32N4O2S/c1-6-15(2)22-21(28)25(11-7-10-24(3)4)14-17-12-16-8-9-18(27-5)13-19(16)23-20(17)26/h8-9,12-13,15H,6-7,10-11,14H2,1-5H3,(H,22,28)(H,23,26)/p+1/t15-/m1/s1 |
| InChIKey | ICRMPOVXHFDVEM-OAHLLOKOSA-O |
| XLogP | 1.55 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|