C21H33N5O2S — CID 3172616
1-[2-(dimethylamino)ethyl]-3-[3-(dimethylamino)propyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]thiourea (PubChem CID 3172616) has the molecular formula C21H33N5O2S and a molecular weight of 419.60 g/mol. Its IUPAC name is 1-[2-(dimethylamino)ethyl]-3-[3-(dimethylamino)propyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]thiourea.
| Compound Name | 1-[2-(dimethylamino)ethyl]-3-[3-(dimethylamino)propyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 3172616 |
| Molecular Formula | C21H33N5O2S |
| Molecular Weight | 419.60 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | 1-[2-(dimethylamino)ethyl]-3-[3-(dimethylamino)propyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
| SMILES | COc1ccc2cc(CN(CCN(C)C)C(=S)NCCCN(C)C)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C21H33N5O2S/c1-24(2)10-6-9-22-21(29)26(12-11-25(3)4)15-17-13-16-7-8-18(28-5)14-19(16)23-20(17)27/h7-8,13-14H,6,9-12,15H2,1-5H3,(H,22,29)(H,23,27) |
| InChIKey | FDDFDFJXXWYUET-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.60 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|