C20H31N4OS+ — CID 7116725
2-[[(2S)-butan-2-yl]carbamothioyl-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]amino]ethyl-dimethylazanium (PubChem CID 7116725) has the molecular formula C20H31N4OS+ and a molecular weight of 375.56 g/mol. Its IUPAC name is 2-[[(2S)-butan-2-yl]carbamothioyl-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[[(2S)-butan-2-yl]carbamothioyl-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7116725 |
| Molecular Formula | C20H31N4OS+ |
| Molecular Weight | 375.56 g/mol |
| Exact Mass | 375.22 |
| IUPAC Name | 2-[[(2S)-butan-2-yl]carbamothioyl-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]amino]ethyl-dimethylazanium |
| SMILES | CC[C@H](C)NC(=S)N(CC[NH+](C)C)Cc1cc2cc(C)ccc2[nH]c1=O |
| InChI | InChI=1S/C20H30N4OS/c1-6-15(3)21-20(26)24(10-9-23(4)5)13-17-12-16-11-14(2)7-8-18(16)22-19(17)25/h7-8,11-12,15H,6,9-10,13H2,1-5H3,(H,21,26)(H,22,25)/p+1/t15-/m0/s1 |
| InChIKey | OVYDOXHQJRSITP-HNNXBMFYSA-O |
| XLogP | 1.46 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.56 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|