C22H27N4O2+ — CID 7141144
dimethyl-[2-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl-(phenylcarbamoyl)amino]ethyl]azanium (PubChem CID 7141144) has the molecular formula C22H27N4O2+ and a molecular weight of 379.48 g/mol. Its IUPAC name is dimethyl-[2-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl-(phenylcarbamoyl)amino]ethyl]azanium.
| Compound Name | dimethyl-[2-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl-(phenylcarbamoyl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 7141144 |
| Molecular Formula | C22H27N4O2+ |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.21 |
| IUPAC Name | dimethyl-[2-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl-(phenylcarbamoyl)amino]ethyl]azanium |
| SMILES | Cc1ccc2[nH]c(=O)c(CN(CC[NH+](C)C)C(=O)Nc3ccccc3)cc2c1 |
| InChI | InChI=1S/C22H26N4O2/c1-16-9-10-20-17(13-16)14-18(21(27)24-20)15-26(12-11-25(2)3)22(28)23-19-7-5-4-6-8-19/h4-10,13-14H,11-12,15H2,1-3H3,(H,23,28)(H,24,27)/p+1 |
| InChIKey | VDNFLOXEMUDOQL-UHFFFAOYSA-O |
| XLogP | 2.02 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |