C19H29N4O2S+ — CID 7116775
3-[ethylcarbamothioyl-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]amino]propyl-dimethylazanium (PubChem CID 7116775) has the molecular formula C19H29N4O2S+ and a molecular weight of 377.53 g/mol. Its IUPAC name is 3-[ethylcarbamothioyl-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]amino]propyl-dimethylazanium.
| Compound Name | 3-[ethylcarbamothioyl-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]amino]propyl-dimethylazanium |
|---|---|
| PubChem CID | 7116775 |
| Molecular Formula | C19H29N4O2S+ |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 3-[ethylcarbamothioyl-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]amino]propyl-dimethylazanium |
| SMILES | CCNC(=S)N(CCC[NH+](C)C)Cc1cc2cc(OC)ccc2[nH]c1=O |
| InChI | InChI=1S/C19H28N4O2S/c1-5-20-19(26)23(10-6-9-22(2)3)13-15-11-14-12-16(25-4)7-8-17(14)21-18(15)24/h7-8,11-12H,5-6,9-10,13H2,1-4H3,(H,20,26)(H,21,24)/p+1 |
| InChIKey | LELPARYFZWXEJS-UHFFFAOYSA-O |
| XLogP | 0.77 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|