C21H33N4O3S+ — CID 7108820
2-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl-(3-methoxypropylcarbamothioyl)amino]ethyl-dimethylazanium (PubChem CID 7108820) has the molecular formula C21H33N4O3S+ and a molecular weight of 421.59 g/mol. Its IUPAC name is 2-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl-(3-methoxypropylcarbamothioyl)amino]ethyl-dimethylazanium.
| Compound Name | 2-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl-(3-methoxypropylcarbamothioyl)amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7108820 |
| Molecular Formula | C21H33N4O3S+ |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | 2-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl-(3-methoxypropylcarbamothioyl)amino]ethyl-dimethylazanium |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(CC[NH+](C)C)C(=S)NCCCOC)cc2c1 |
| InChI | InChI=1S/C21H32N4O3S/c1-5-28-18-7-8-19-16(14-18)13-17(20(26)23-19)15-25(11-10-24(2)3)21(29)22-9-6-12-27-4/h7-8,13-14H,5-6,9-12,15H2,1-4H3,(H,22,29)(H,23,26)/p+1 |
| InChIKey | MXWOZHPNJPDITM-UHFFFAOYSA-O |
| XLogP | 0.78 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|