C24H39N5O2S — CID 3174073
1-[2-(diethylamino)ethyl]-3-[3-(dimethylamino)propyl]-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]thiourea (PubChem CID 3174073) has the molecular formula C24H39N5O2S and a molecular weight of 461.68 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-3-[3-(dimethylamino)propyl]-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]thiourea.
| Compound Name | 1-[2-(diethylamino)ethyl]-3-[3-(dimethylamino)propyl]-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 3174073 |
| Molecular Formula | C24H39N5O2S |
| Molecular Weight | 461.68 g/mol |
| Exact Mass | 461.28 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-3-[3-(dimethylamino)propyl]-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(CCN(CC)CC)C(=S)NCCCN(C)C)cc2c1 |
| InChI | InChI=1S/C24H39N5O2S/c1-6-28(7-2)14-15-29(24(32)25-12-9-13-27(4)5)18-20-16-19-17-21(31-8-3)10-11-22(19)26-23(20)30/h10-11,16-17H,6-9,12-15,18H2,1-5H3,(H,25,32)(H,26,30) |
| InChIKey | DFPTWBRMOFSDQY-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 63.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.68 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|