C27H35FN4O2S — CID 3172129
3-[3-(diethylamino)propyl]-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]thiourea (PubChem CID 3172129) has the molecular formula C27H35FN4O2S and a molecular weight of 498.67 g/mol. Its IUPAC name is 3-[3-(diethylamino)propyl]-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]thiourea.
| Compound Name | 3-[3-(diethylamino)propyl]-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]thiourea |
|---|---|
| PubChem CID | 3172129 |
| Molecular Formula | C27H35FN4O2S |
| Molecular Weight | 498.67 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | 3-[3-(diethylamino)propyl]-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]thiourea |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(Cc3ccc(F)cc3)C(=S)NCCCN(CC)CC)cc2c1 |
| InChI | InChI=1S/C27H35FN4O2S/c1-4-31(5-2)15-7-14-29-27(35)32(18-20-8-10-23(28)11-9-20)19-22-16-21-17-24(34-6-3)12-13-25(21)30-26(22)33/h8-13,16-17H,4-7,14-15,18-19H2,1-3H3,(H,29,35)(H,30,33) |
| InChIKey | YWTYAXIFHOVRLI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.67 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|