C28H29N3O4S — CID 1166336
1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 1166336) has the molecular formula C28H29N3O4S and a molecular weight of 503.62 g/mol. Its IUPAC name is 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 1166336 |
| Molecular Formula | C28H29N3O4S |
| Molecular Weight | 503.62 g/mol |
| Exact Mass | 503.19 |
| IUPAC Name | 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-methoxyphenyl)-1-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(Cc3ccc(OC)cc3)C(=S)Nc3cccc(OC)c3)cc2c1 |
| InChI | InChI=1S/C28H29N3O4S/c1-4-35-25-12-13-26-20(15-25)14-21(27(32)30-26)18-31(17-19-8-10-23(33-2)11-9-19)28(36)29-22-6-5-7-24(16-22)34-3/h5-16H,4,17-18H2,1-3H3,(H,29,36)(H,30,32) |
| InChIKey | XHCOESOOOALPEX-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.62 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|