C26H24FN3O2S — CID 1134226
1-[(4-fluorophenyl)methyl]-3-(4-methoxyphenyl)-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea (PubChem CID 1134226) has the molecular formula C26H24FN3O2S and a molecular weight of 461.56 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-(4-methoxyphenyl)-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-(4-methoxyphenyl)-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 1134226 |
| Molecular Formula | C26H24FN3O2S |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-(4-methoxyphenyl)-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
| SMILES | COc1ccc(NC(=S)N(Cc2ccc(F)cc2)Cc2cc3cc(C)ccc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C26H24FN3O2S/c1-17-3-12-24-19(13-17)14-20(25(31)29-24)16-30(15-18-4-6-21(27)7-5-18)26(33)28-22-8-10-23(32-2)11-9-22/h3-14H,15-16H2,1-2H3,(H,28,33)(H,29,31) |
| InChIKey | LEIZWHDQXZUYPE-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|