C27H26FN3O2S — CID 1141215
1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-fluorophenyl)-1-[(4-methoxyphenyl)methyl]thiourea (PubChem CID 1141215) has the molecular formula C27H26FN3O2S and a molecular weight of 475.59 g/mol. Its IUPAC name is 1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-fluorophenyl)-1-[(4-methoxyphenyl)methyl]thiourea.
| Compound Name | 1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-fluorophenyl)-1-[(4-methoxyphenyl)methyl]thiourea |
|---|---|
| PubChem CID | 1141215 |
| Molecular Formula | C27H26FN3O2S |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | 1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-fluorophenyl)-1-[(4-methoxyphenyl)methyl]thiourea |
| SMILES | COc1ccc(CN(Cc2cc3cc(C)c(C)cc3[nH]c2=O)C(=S)Nc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C27H26FN3O2S/c1-17-12-20-14-21(26(32)30-25(20)13-18(17)2)16-31(15-19-4-10-24(33-3)11-5-19)27(34)29-23-8-6-22(28)7-9-23/h4-14H,15-16H2,1-3H3,(H,29,34)(H,30,32) |
| InChIKey | OVCDZBKGMFJGRJ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|