C27H26FN3O4S — CID 1149871
1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-(2-methoxyphenyl)thiourea (PubChem CID 1149871) has the molecular formula C27H26FN3O4S and a molecular weight of 507.59 g/mol. Its IUPAC name is 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-(2-methoxyphenyl)thiourea.
| Compound Name | 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-(2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 1149871 |
| Molecular Formula | C27H26FN3O4S |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-(2-methoxyphenyl)thiourea |
| SMILES | COc1ccccc1NC(=S)N(Cc1ccc(F)cc1)Cc1cc2cc(OC)c(OC)cc2[nH]c1=O |
| InChI | InChI=1S/C27H26FN3O4S/c1-33-23-7-5-4-6-21(23)30-27(36)31(15-17-8-10-20(28)11-9-17)16-19-12-18-13-24(34-2)25(35-3)14-22(18)29-26(19)32/h4-14H,15-16H2,1-3H3,(H,29,32)(H,30,36) |
| InChIKey | CRXOXRWXTUAWLS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|