C27H26FN3OS — CID 3176963
3-(2-ethylphenyl)-1-[(4-fluorophenyl)methyl]-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea (PubChem CID 3176963) has the molecular formula C27H26FN3OS and a molecular weight of 459.59 g/mol. Its IUPAC name is 3-(2-ethylphenyl)-1-[(4-fluorophenyl)methyl]-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea.
| Compound Name | 3-(2-ethylphenyl)-1-[(4-fluorophenyl)methyl]-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 3176963 |
| Molecular Formula | C27H26FN3OS |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 3-(2-ethylphenyl)-1-[(4-fluorophenyl)methyl]-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
| SMILES | CCc1ccccc1NC(=S)N(Cc1ccc(F)cc1)Cc1cc2cc(C)ccc2[nH]c1=O |
| InChI | InChI=1S/C27H26FN3OS/c1-3-20-6-4-5-7-24(20)30-27(33)31(16-19-9-11-23(28)12-10-19)17-22-15-21-14-18(2)8-13-25(21)29-26(22)32/h4-15H,3,16-17H2,1-2H3,(H,29,32)(H,30,33) |
| InChIKey | WMLPMFPFQALTBA-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|