C28H28FN3OS — CID 40595015
1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-[(1R)-1-phenylethyl]thiourea (PubChem CID 40595015) has the molecular formula C28H28FN3OS and a molecular weight of 473.62 g/mol. Its IUPAC name is 1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-[(1R)-1-phenylethyl]thiourea.
| Compound Name | 1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-[(1R)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 40595015 |
| Molecular Formula | C28H28FN3OS |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | 1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-[(1R)-1-phenylethyl]thiourea |
| SMILES | CCc1ccc2[nH]c(=O)c(CN(Cc3ccc(F)cc3)C(=S)N[C@H](C)c3ccccc3)cc2c1 |
| InChI | InChI=1S/C28H28FN3OS/c1-3-20-11-14-26-23(15-20)16-24(27(33)31-26)18-32(17-21-9-12-25(29)13-10-21)28(34)30-19(2)22-7-5-4-6-8-22/h4-16,19H,3,17-18H2,1-2H3,(H,30,34)(H,31,33)/t19-/m1/s1 |
| InChIKey | RNIVBPQQWULOKM-LJQANCHMSA-N |
| XLogP | 5.87 |
| TPSA | 48.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|