C26H31N3O2S — CID 1169368
1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]-3-[(1R)-1-phenylethyl]thiourea (PubChem CID 1169368) has the molecular formula C26H31N3O2S and a molecular weight of 449.62 g/mol. Its IUPAC name is 1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]-3-[(1R)-1-phenylethyl]thiourea.
| Compound Name | 1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]-3-[(1R)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 1169368 |
| Molecular Formula | C26H31N3O2S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]-3-[(1R)-1-phenylethyl]thiourea |
| SMILES | CCc1ccc2[nH]c(=O)c(CN(C[C@H]3CCCO3)C(=S)N[C@H](C)c3ccccc3)cc2c1 |
| InChI | InChI=1S/C26H31N3O2S/c1-3-19-11-12-24-21(14-19)15-22(25(30)28-24)16-29(17-23-10-7-13-31-23)26(32)27-18(2)20-8-5-4-6-9-20/h4-6,8-9,11-12,14-15,18,23H,3,7,10,13,16-17H2,1-2H3,(H,27,32)(H,28,30)/t18-,23-/m1/s1 |
| InChIKey | LGGLKEOKODDIEW-WZONZLPQSA-N |
| XLogP | 4.71 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|