C26H31N3O3S — CID 3170371
3-(4-ethoxyphenyl)-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(oxolan-2-ylmethyl)thiourea (PubChem CID 3170371) has the molecular formula C26H31N3O3S and a molecular weight of 465.62 g/mol. Its IUPAC name is 3-(4-ethoxyphenyl)-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 3-(4-ethoxyphenyl)-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3170371 |
| Molecular Formula | C26H31N3O3S |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | 3-(4-ethoxyphenyl)-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(oxolan-2-ylmethyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)N(Cc2cc3cc(CC)ccc3[nH]c2=O)CC2CCCO2)cc1 |
| InChI | InChI=1S/C26H31N3O3S/c1-3-18-7-12-24-19(14-18)15-20(25(30)28-24)16-29(17-23-6-5-13-32-23)26(33)27-21-8-10-22(11-9-21)31-4-2/h7-12,14-15,23H,3-6,13,16-17H2,1-2H3,(H,27,33)(H,28,30) |
| InChIKey | PGGOZTJPCWPRFS-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|