C24H33N3O2S — CID 1169379
3-cyclohexyl-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 1169379) has the molecular formula C24H33N3O2S and a molecular weight of 427.61 g/mol. Its IUPAC name is 3-cyclohexyl-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 3-cyclohexyl-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 1169379 |
| Molecular Formula | C24H33N3O2S |
| Molecular Weight | 427.61 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | 3-cyclohexyl-1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | CCc1ccc2[nH]c(=O)c(CN(C[C@H]3CCCO3)C(=S)NC3CCCCC3)cc2c1 |
| InChI | InChI=1S/C24H33N3O2S/c1-2-17-10-11-22-18(13-17)14-19(23(28)26-22)15-27(16-21-9-6-12-29-21)24(30)25-20-7-4-3-5-8-20/h10-11,13-14,20-21H,2-9,12,15-16H2,1H3,(H,25,30)(H,26,28)/t21-/m1/s1 |
| InChIKey | SWULRLBTQVDJFL-OAQYLSRUSA-N |
| XLogP | 4.28 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.61 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|