C23H27N3O3S — CID 1169377
1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(furan-2-ylmethyl)-1-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 1169377) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is 1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(furan-2-ylmethyl)-1-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(furan-2-ylmethyl)-1-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 1169377 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 1-[(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(furan-2-ylmethyl)-1-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | CCc1ccc2[nH]c(=O)c(CN(C[C@H]3CCCO3)C(=S)NCc3ccco3)cc2c1 |
| InChI | InChI=1S/C23H27N3O3S/c1-2-16-7-8-21-17(11-16)12-18(22(27)25-21)14-26(15-20-6-4-10-29-20)23(30)24-13-19-5-3-9-28-19/h3,5,7-9,11-12,20H,2,4,6,10,13-15H2,1H3,(H,24,30)(H,25,27)/t20-/m1/s1 |
| InChIKey | RMGDWHKIXIDZQN-HXUWFJFHSA-N |
| XLogP | 3.74 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|