C23H27N3O4S — CID 1140353
1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(furan-2-ylmethyl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 1140353) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(furan-2-ylmethyl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(furan-2-ylmethyl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 1140353 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(furan-2-ylmethyl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(Cc3ccco3)C(=S)NC[C@@H]3CCCO3)cc2c1 |
| InChI | InChI=1S/C23H27N3O4S/c1-2-28-18-7-8-21-16(12-18)11-17(22(27)25-21)14-26(15-20-6-4-10-30-20)23(31)24-13-19-5-3-9-29-19/h4,6-8,10-12,19H,2-3,5,9,13-15H2,1H3,(H,24,31)(H,25,27)/t19-/m0/s1 |
| InChIKey | GBHCFGOINJHPSQ-IBGZPJMESA-N |
| XLogP | 3.58 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|