C25H29N3O4S — CID 3173925
1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 3173925) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is 1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3173925 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 1-[(6-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | COc1ccc(CN(Cc2cc3cc(OC)ccc3[nH]c2=O)C(=S)NCC2CCCO2)cc1 |
| InChI | InChI=1S/C25H29N3O4S/c1-30-20-7-5-17(6-8-20)15-28(25(33)26-14-22-4-3-11-32-22)16-19-12-18-13-21(31-2)9-10-23(18)27-24(19)29/h5-10,12-13,22H,3-4,11,14-16H2,1-2H3,(H,26,33)(H,27,29) |
| InChIKey | HXZRIVSBEDOPEM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|