C22H29N3O3S — CID 1374732
1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1,3-bis[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 1374732) has the molecular formula C22H29N3O3S and a molecular weight of 415.56 g/mol. Its IUPAC name is 1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1,3-bis[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1,3-bis[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 1374732 |
| Molecular Formula | C22H29N3O3S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1,3-bis[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | Cc1ccc2[nH]c(=O)c(CN(C[C@@H]3CCCO3)C(=S)NC[C@@H]3CCCO3)cc2c1 |
| InChI | InChI=1S/C22H29N3O3S/c1-15-6-7-20-16(10-15)11-17(21(26)24-20)13-25(14-19-5-3-9-28-19)22(29)23-12-18-4-2-8-27-18/h6-7,10-11,18-19H,2-5,8-9,12-14H2,1H3,(H,23,29)(H,24,26)/t18-,19-/m0/s1 |
| InChIKey | YZJFZBLWZLCLAX-OALUTQOASA-N |
| XLogP | 2.87 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|