C25H29N3O2S — CID 1374728
1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[[(2S)-oxolan-2-yl]methyl]-3-[(1R)-1-phenylethyl]thiourea (PubChem CID 1374728) has the molecular formula C25H29N3O2S and a molecular weight of 435.59 g/mol. Its IUPAC name is 1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[[(2S)-oxolan-2-yl]methyl]-3-[(1R)-1-phenylethyl]thiourea.
| Compound Name | 1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[[(2S)-oxolan-2-yl]methyl]-3-[(1R)-1-phenylethyl]thiourea |
|---|---|
| PubChem CID | 1374728 |
| Molecular Formula | C25H29N3O2S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[[(2S)-oxolan-2-yl]methyl]-3-[(1R)-1-phenylethyl]thiourea |
| SMILES | Cc1ccc2[nH]c(=O)c(CN(C[C@@H]3CCCO3)C(=S)N[C@H](C)c3ccccc3)cc2c1 |
| InChI | InChI=1S/C25H29N3O2S/c1-17-10-11-23-20(13-17)14-21(24(29)27-23)15-28(16-22-9-6-12-30-22)25(31)26-18(2)19-7-4-3-5-8-19/h3-5,7-8,10-11,13-14,18,22H,6,9,12,15-16H2,1-2H3,(H,26,31)(H,27,29)/t18-,22+/m1/s1 |
| InChIKey | GPDACQFPLCJMKR-GCJKJVERSA-N |
| XLogP | 4.45 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|