C23H24FN3O2S — CID 3171179
3-(4-fluorophenyl)-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(oxolan-2-ylmethyl)thiourea (PubChem CID 3171179) has the molecular formula C23H24FN3O2S and a molecular weight of 425.53 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 3-(4-fluorophenyl)-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3171179 |
| Molecular Formula | C23H24FN3O2S |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 3-(4-fluorophenyl)-1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(oxolan-2-ylmethyl)thiourea |
| SMILES | Cc1ccc2[nH]c(=O)c(CN(CC3CCCO3)C(=S)Nc3ccc(F)cc3)cc2c1 |
| InChI | InChI=1S/C23H24FN3O2S/c1-15-4-9-21-16(11-15)12-17(22(28)26-21)13-27(14-20-3-2-10-29-20)23(30)25-19-7-5-18(24)6-8-19/h4-9,11-12,20H,2-3,10,13-14H2,1H3,(H,25,30)(H,26,28) |
| InChIKey | GPXBVXQNKDMHPX-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|