C25H29N3O2S — CID 3170840
1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-methylphenyl)-1-(oxolan-2-ylmethyl)thiourea (PubChem CID 3170840) has the molecular formula C25H29N3O2S and a molecular weight of 435.59 g/mol. Its IUPAC name is 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-methylphenyl)-1-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-methylphenyl)-1-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3170840 |
| Molecular Formula | C25H29N3O2S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.20 |
| IUPAC Name | 1-[(6,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-methylphenyl)-1-(oxolan-2-ylmethyl)thiourea |
| SMILES | Cc1ccc(NC(=S)N(Cc2cc3cc(C)cc(C)c3[nH]c2=O)CC2CCCO2)cc1 |
| InChI | InChI=1S/C25H29N3O2S/c1-16-6-8-21(9-7-16)26-25(31)28(15-22-5-4-10-30-22)14-20-13-19-12-17(2)11-18(3)23(19)27-24(20)29/h6-9,11-13,22H,4-5,10,14-15H2,1-3H3,(H,26,31)(H,27,29) |
| InChIKey | UJMMLAILCZGMDI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|