C20H27N3O3S — CID 3169369
1-(3-hydroxypropyl)-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 3169369) has the molecular formula C20H27N3O3S and a molecular weight of 389.52 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-(3-hydroxypropyl)-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3169369 |
| Molecular Formula | C20H27N3O3S |
| Molecular Weight | 389.52 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 1-(3-hydroxypropyl)-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | Cc1ccc2cc(CN(CCCO)C(=S)NCC3CCCO3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C20H27N3O3S/c1-14-5-6-15-11-16(19(25)22-18(15)10-14)13-23(7-3-8-24)20(27)21-12-17-4-2-9-26-17/h5-6,10-11,17,24H,2-4,7-9,12-13H2,1H3,(H,21,27)(H,22,25) |
| InChIKey | RFKVDDPIWGAXRP-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|