C22H29N3O4S — CID 3172217
1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1,3-bis(oxolan-2-ylmethyl)thiourea (PubChem CID 3172217) has the molecular formula C22H29N3O4S and a molecular weight of 431.56 g/mol. Its IUPAC name is 1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1,3-bis(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1,3-bis(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3172217 |
| Molecular Formula | C22H29N3O4S |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | 1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-1,3-bis(oxolan-2-ylmethyl)thiourea |
| SMILES | COc1ccc2cc(CN(CC3CCCO3)C(=S)NCC3CCCO3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C22H29N3O4S/c1-27-17-7-6-15-10-16(21(26)24-20(15)11-17)13-25(14-19-5-3-9-29-19)22(30)23-12-18-4-2-8-28-18/h6-7,10-11,18-19H,2-5,8-9,12-14H2,1H3,(H,23,30)(H,24,26) |
| InChIKey | IQPOVGFQAOLJIJ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|