C24H26FN3O3S — CID 3172235
1-[(4-fluorophenyl)methyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 3172235) has the molecular formula C24H26FN3O3S and a molecular weight of 455.56 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[(4-fluorophenyl)methyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3172235 |
| Molecular Formula | C24H26FN3O3S |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | COc1ccc2cc(CN(Cc3ccc(F)cc3)C(=S)NCC3CCCO3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C24H26FN3O3S/c1-30-20-9-6-17-11-18(23(29)27-22(17)12-20)15-28(14-16-4-7-19(25)8-5-16)24(32)26-13-21-3-2-10-31-21/h4-9,11-12,21H,2-3,10,13-15H2,1H3,(H,26,32)(H,27,29) |
| InChIKey | JGQIVLGBGSWODU-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|