C25H28FN3O2S — CID 1134307
1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 1134307) has the molecular formula C25H28FN3O2S and a molecular weight of 453.58 g/mol. Its IUPAC name is 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 1134307 |
| Molecular Formula | C25H28FN3O2S |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-fluorophenyl)methyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | Cc1ccc2cc(CN(Cc3ccc(F)cc3)C(=S)NC[C@H]3CCCO3)c(=O)[nH]c2c1C |
| InChI | InChI=1S/C25H28FN3O2S/c1-16-5-8-19-12-20(24(30)28-23(19)17(16)2)15-29(14-18-6-9-21(26)10-7-18)25(32)27-13-22-4-3-11-31-22/h5-10,12,22H,3-4,11,13-15H2,1-2H3,(H,27,32)(H,28,30)/t22-/m1/s1 |
| InChIKey | JASFYQZWQUNUSL-JOCHJYFZSA-N |
| XLogP | 4.34 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|