C26H31N3O2S — CID 3171154
1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(oxolan-2-ylmethyl)-3-(2-phenylethyl)thiourea (PubChem CID 3171154) has the molecular formula C26H31N3O2S and a molecular weight of 449.62 g/mol. Its IUPAC name is 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(oxolan-2-ylmethyl)-3-(2-phenylethyl)thiourea.
| Compound Name | 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(oxolan-2-ylmethyl)-3-(2-phenylethyl)thiourea |
|---|---|
| PubChem CID | 3171154 |
| Molecular Formula | C26H31N3O2S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(oxolan-2-ylmethyl)-3-(2-phenylethyl)thiourea |
| SMILES | Cc1ccc2cc(CN(CC3CCCO3)C(=S)NCCc3ccccc3)c(=O)[nH]c2c1C |
| InChI | InChI=1S/C26H31N3O2S/c1-18-10-11-21-15-22(25(30)28-24(21)19(18)2)16-29(17-23-9-6-14-31-23)26(32)27-13-12-20-7-4-3-5-8-20/h3-5,7-8,10-11,15,23H,6,9,12-14,16-17H2,1-2H3,(H,27,32)(H,28,30) |
| InChIKey | AICSAUCRDMGJHM-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|