C24H28N4O2S — CID 1175194
1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-[[(2S)-oxolan-2-yl]methyl]-1-(pyridin-3-ylmethyl)thiourea (PubChem CID 1175194) has the molecular formula C24H28N4O2S and a molecular weight of 436.58 g/mol. Its IUPAC name is 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-[[(2S)-oxolan-2-yl]methyl]-1-(pyridin-3-ylmethyl)thiourea.
| Compound Name | 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-[[(2S)-oxolan-2-yl]methyl]-1-(pyridin-3-ylmethyl)thiourea |
|---|---|
| PubChem CID | 1175194 |
| Molecular Formula | C24H28N4O2S |
| Molecular Weight | 436.58 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | 1-[(7,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-[[(2S)-oxolan-2-yl]methyl]-1-(pyridin-3-ylmethyl)thiourea |
| SMILES | Cc1ccc2cc(CN(Cc3cccnc3)C(=S)NC[C@@H]3CCCO3)c(=O)[nH]c2c1C |
| InChI | InChI=1S/C24H28N4O2S/c1-16-7-8-19-11-20(23(29)27-22(19)17(16)2)15-28(14-18-5-3-9-25-12-18)24(31)26-13-21-6-4-10-30-21/h3,5,7-9,11-12,21H,4,6,10,13-15H2,1-2H3,(H,26,31)(H,27,29)/t21-/m0/s1 |
| InChIKey | CAPMUHLPUHPQKZ-NRFANRHFSA-N |
| XLogP | 3.60 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.58 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|