C24H27N3O3S — CID 3172144
1-benzyl-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 3172144) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is 1-benzyl-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-benzyl-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3172144 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 1-benzyl-1-[(7-methoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | COc1ccc2cc(CN(Cc3ccccc3)C(=S)NCC3CCCO3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C24H27N3O3S/c1-29-20-10-9-18-12-19(23(28)26-22(18)13-20)16-27(15-17-6-3-2-4-7-17)24(31)25-14-21-8-5-11-30-21/h2-4,6-7,9-10,12-13,21H,5,8,11,14-16H2,1H3,(H,25,31)(H,26,28) |
| InChIKey | DWQIFFOKQDOCOS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|