C26H31N3O4S — CID 40594644
1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea (PubChem CID 40594644) has the molecular formula C26H31N3O4S and a molecular weight of 481.62 g/mol. Its IUPAC name is 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 40594644 |
| Molecular Formula | C26H31N3O4S |
| Molecular Weight | 481.62 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-[(4-methoxyphenyl)methyl]-3-[[(2R)-oxolan-2-yl]methyl]thiourea |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(Cc3ccc(OC)cc3)C(=S)NC[C@H]3CCCO3)cc2c1 |
| InChI | InChI=1S/C26H31N3O4S/c1-3-32-22-10-11-24-19(14-22)13-20(25(30)28-24)17-29(16-18-6-8-21(31-2)9-7-18)26(34)27-15-23-5-4-12-33-23/h6-11,13-14,23H,3-5,12,15-17H2,1-2H3,(H,27,34)(H,28,30)/t23-/m1/s1 |
| InChIKey | UOJPBBWGJKDONK-HSZRJFAPSA-N |
| XLogP | 3.99 |
| TPSA | 75.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.62 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|