C24H34N4O3S — CID 40611606
1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-morpholin-4-ylpropyl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea (PubChem CID 40611606) has the molecular formula C24H34N4O3S and a molecular weight of 458.63 g/mol. Its IUPAC name is 1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-morpholin-4-ylpropyl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea.
| Compound Name | 1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-morpholin-4-ylpropyl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
|---|---|
| PubChem CID | 40611606 |
| Molecular Formula | C24H34N4O3S |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 1-[(6-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-morpholin-4-ylpropyl)-3-[[(2S)-oxolan-2-yl]methyl]thiourea |
| SMILES | Cc1ccc2[nH]c(=O)c(CN(CCCN3CCOCC3)C(=S)NC[C@@H]3CCCO3)cc2c1 |
| InChI | InChI=1S/C24H34N4O3S/c1-18-5-6-22-19(14-18)15-20(23(29)26-22)17-28(8-3-7-27-9-12-30-13-10-27)24(32)25-16-21-4-2-11-31-21/h5-6,14-15,21H,2-4,7-13,16-17H2,1H3,(H,25,32)(H,26,29)/t21-/m0/s1 |
| InChIKey | CIWPUYKANAWTEW-NRFANRHFSA-N |
| XLogP | 2.41 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|