C25H36N4O3S — CID 3171793
1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-morpholin-4-ylpropyl)-3-(oxolan-2-ylmethyl)thiourea (PubChem CID 3171793) has the molecular formula C25H36N4O3S and a molecular weight of 472.66 g/mol. Its IUPAC name is 1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-morpholin-4-ylpropyl)-3-(oxolan-2-ylmethyl)thiourea.
| Compound Name | 1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-morpholin-4-ylpropyl)-3-(oxolan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 3171793 |
| Molecular Formula | C25H36N4O3S |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | 1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-morpholin-4-ylpropyl)-3-(oxolan-2-ylmethyl)thiourea |
| SMILES | Cc1ccc(C)c2[nH]c(=O)c(CN(CCCN3CCOCC3)C(=S)NCC3CCCO3)cc12 |
| InChI | InChI=1S/C25H36N4O3S/c1-18-6-7-19(2)23-22(18)15-20(24(30)27-23)17-29(9-4-8-28-10-13-31-14-11-28)25(33)26-16-21-5-3-12-32-21/h6-7,15,21H,3-5,8-14,16-17H2,1-2H3,(H,26,33)(H,27,30) |
| InChIKey | FIOPDOQCSNSZEN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|