C23H34N4O3S — CID 3171782
1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-methoxypropyl)-1-(2-morpholin-4-ylethyl)thiourea (PubChem CID 3171782) has the molecular formula C23H34N4O3S and a molecular weight of 446.62 g/mol. Its IUPAC name is 1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-methoxypropyl)-1-(2-morpholin-4-ylethyl)thiourea.
| Compound Name | 1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-methoxypropyl)-1-(2-morpholin-4-ylethyl)thiourea |
|---|---|
| PubChem CID | 3171782 |
| Molecular Formula | C23H34N4O3S |
| Molecular Weight | 446.62 g/mol |
| Exact Mass | 446.24 |
| IUPAC Name | 1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(3-methoxypropyl)-1-(2-morpholin-4-ylethyl)thiourea |
| SMILES | COCCCNC(=S)N(CCN1CCOCC1)Cc1cc2c(C)ccc(C)c2[nH]c1=O |
| InChI | InChI=1S/C23H34N4O3S/c1-17-5-6-18(2)21-20(17)15-19(22(28)25-21)16-27(23(31)24-7-4-12-29-3)9-8-26-10-13-30-14-11-26/h5-6,15H,4,7-14,16H2,1-3H3,(H,24,31)(H,25,28) |
| InChIKey | VRWQSLWAVPJCMK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.62 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|