C28H36N4O3S — CID 3171788
1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 3171788) has the molecular formula C28H36N4O3S and a molecular weight of 508.69 g/mol. Its IUPAC name is 1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 3171788 |
| Molecular Formula | C28H36N4O3S |
| Molecular Weight | 508.69 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | 1-[(5,8-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)N(CCCN2CCOCC2)Cc2cc3c(C)ccc(C)c3[nH]c2=O)cc1 |
| InChI | InChI=1S/C28H36N4O3S/c1-4-35-24-10-8-23(9-11-24)29-28(36)32(13-5-12-31-14-16-34-17-15-31)19-22-18-25-20(2)6-7-21(3)26(25)30-27(22)33/h6-11,18H,4-5,12-17,19H2,1-3H3,(H,29,36)(H,30,33) |
| InChIKey | HWJDAINYCMBYHV-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.69 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|