C28H36N4O5S — CID 1149798
1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 1149798) has the molecular formula C28H36N4O5S and a molecular weight of 540.69 g/mol. Its IUPAC name is 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 1149798 |
| Molecular Formula | C28H36N4O5S |
| Molecular Weight | 540.69 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 1-[(6,7-dimethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)N(CCCN2CCOCC2)Cc2cc3cc(OC)c(OC)cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C28H36N4O5S/c1-4-37-23-8-6-22(7-9-23)29-28(38)32(11-5-10-31-12-14-36-15-13-31)19-21-16-20-17-25(34-2)26(35-3)18-24(20)30-27(21)33/h6-9,16-18H,4-5,10-15,19H2,1-3H3,(H,29,38)(H,30,33) |
| InChIKey | DYQXZOJYOLQANO-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 88.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.69 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|