C24H29N3O3S — CID 3171891
1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(3-hydroxypropyl)thiourea (PubChem CID 3171891) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is 1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(3-hydroxypropyl)thiourea.
| Compound Name | 1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(3-hydroxypropyl)thiourea |
|---|---|
| PubChem CID | 3171891 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 1-[(6,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-ethoxyphenyl)-1-(3-hydroxypropyl)thiourea |
| SMILES | CCOc1ccc(NC(=S)N(CCCO)Cc2cc3cc(C)c(C)cc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C24H29N3O3S/c1-4-30-21-8-6-20(7-9-21)25-24(31)27(10-5-11-28)15-19-14-18-12-16(2)17(3)13-22(18)26-23(19)29/h6-9,12-14,28H,4-5,10-11,15H2,1-3H3,(H,25,31)(H,26,29) |
| InChIKey | AJRTYOXVDUCNMF-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|