C26H34N4O3S — CID 3174059
1-[2-(diethylamino)ethyl]-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-methoxyphenyl)thiourea (PubChem CID 3174059) has the molecular formula C26H34N4O3S and a molecular weight of 482.65 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-methoxyphenyl)thiourea.
| Compound Name | 1-[2-(diethylamino)ethyl]-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 3174059 |
| Molecular Formula | C26H34N4O3S |
| Molecular Weight | 482.65 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(4-methoxyphenyl)thiourea |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(CCN(CC)CC)C(=S)Nc3ccc(OC)cc3)cc2c1 |
| InChI | InChI=1S/C26H34N4O3S/c1-5-29(6-2)14-15-30(26(34)27-21-8-10-22(32-4)11-9-21)18-20-16-19-17-23(33-7-3)12-13-24(19)28-25(20)31/h8-13,16-17H,5-7,14-15,18H2,1-4H3,(H,27,34)(H,28,31) |
| InChIKey | JEUNPBJMQMEQSW-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 69.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.65 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|