C22H25N3O5 — CID 1430887
1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-hydroxyethyl)-3-(4-methoxyphenyl)urea (PubChem CID 1430887) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-hydroxyethyl)-3-(4-methoxyphenyl)urea.
| Compound Name | 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-hydroxyethyl)-3-(4-methoxyphenyl)urea |
|---|---|
| PubChem CID | 1430887 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-hydroxyethyl)-3-(4-methoxyphenyl)urea |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(CCO)C(=O)Nc3ccc(OC)cc3)cc2c1 |
| InChI | InChI=1S/C22H25N3O5/c1-3-30-19-8-9-20-15(13-19)12-16(21(27)24-20)14-25(10-11-26)22(28)23-17-4-6-18(29-2)7-5-17/h4-9,12-13,26H,3,10-11,14H2,1-2H3,(H,23,28)(H,24,27) |
| InChIKey | XRUNRYBCHSCVOF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 103.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |