C22H24FN3O4 — CID 3194782
1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-fluorophenyl)-1-(3-hydroxypropyl)urea (PubChem CID 3194782) has the molecular formula C22H24FN3O4 and a molecular weight of 413.45 g/mol. Its IUPAC name is 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-fluorophenyl)-1-(3-hydroxypropyl)urea.
| Compound Name | 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-fluorophenyl)-1-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 3194782 |
| Molecular Formula | C22H24FN3O4 |
| Molecular Weight | 413.45 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-3-(2-fluorophenyl)-1-(3-hydroxypropyl)urea |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(CCCO)C(=O)Nc3ccccc3F)cc2c1 |
| InChI | InChI=1S/C22H24FN3O4/c1-2-30-17-8-9-19-15(13-17)12-16(21(28)24-19)14-26(10-5-11-27)22(29)25-20-7-4-3-6-18(20)23/h3-4,6-9,12-13,27H,2,5,10-11,14H2,1H3,(H,24,28)(H,25,29) |
| InChIKey | VCJUPGDLESMEPX-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 94.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.45 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |