C20H29N3O3S — CID 3172053
1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-hydroxypropyl)-3-(2-methylpropyl)thiourea (PubChem CID 3172053) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-hydroxypropyl)-3-(2-methylpropyl)thiourea.
| Compound Name | 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-hydroxypropyl)-3-(2-methylpropyl)thiourea |
|---|---|
| PubChem CID | 3172053 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-hydroxypropyl)-3-(2-methylpropyl)thiourea |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(CCCO)C(=S)NCC(C)C)cc2c1 |
| InChI | InChI=1S/C20H29N3O3S/c1-4-26-17-6-7-18-15(11-17)10-16(19(25)22-18)13-23(8-5-9-24)20(27)21-12-14(2)3/h6-7,10-11,14,24H,4-5,8-9,12-13H2,1-3H3,(H,21,27)(H,22,25) |
| InChIKey | NEEYVRCINGVISG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 77.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|