C25H30N4O4S — CID 1142115
methyl 2-[[2-(dimethylamino)ethyl-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]carbamothioyl]amino]benzoate (PubChem CID 1142115) has the molecular formula C25H30N4O4S and a molecular weight of 482.61 g/mol. Its IUPAC name is methyl 2-[[2-(dimethylamino)ethyl-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]carbamothioyl]amino]benzoate.
| Compound Name | methyl 2-[[2-(dimethylamino)ethyl-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]carbamothioyl]amino]benzoate |
|---|---|
| PubChem CID | 1142115 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | methyl 2-[[2-(dimethylamino)ethyl-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]carbamothioyl]amino]benzoate |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(CCN(C)C)C(=S)Nc3ccccc3C(=O)OC)cc2c1 |
| InChI | InChI=1S/C25H30N4O4S/c1-5-33-19-10-11-21-17(15-19)14-18(23(30)26-21)16-29(13-12-28(2)3)25(34)27-22-9-7-6-8-20(22)24(31)32-4/h6-11,14-15H,5,12-13,16H2,1-4H3,(H,26,30)(H,27,34) |
| InChIKey | LNPKUAVJMBRSOE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|