C23H34N4O2S — CID 1138319
3-cyclohexyl-1-[2-(dimethylamino)ethyl]-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]thiourea (PubChem CID 1138319) has the molecular formula C23H34N4O2S and a molecular weight of 430.62 g/mol. Its IUPAC name is 3-cyclohexyl-1-[2-(dimethylamino)ethyl]-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]thiourea.
| Compound Name | 3-cyclohexyl-1-[2-(dimethylamino)ethyl]-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 1138319 |
| Molecular Formula | C23H34N4O2S |
| Molecular Weight | 430.62 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 3-cyclohexyl-1-[2-(dimethylamino)ethyl]-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]thiourea |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(CCN(C)C)C(=S)NC3CCCCC3)cc2c1 |
| InChI | InChI=1S/C23H34N4O2S/c1-4-29-20-10-11-21-17(15-20)14-18(22(28)25-21)16-27(13-12-26(2)3)23(30)24-19-8-6-5-7-9-19/h10-11,14-15,19H,4-9,12-13,16H2,1-3H3,(H,24,30)(H,25,28) |
| InChIKey | HGDVJZFUMXFOFB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.62 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|