C25H36N4O4 — CID 1138164
3-cyclohexyl-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)urea (PubChem CID 1138164) has the molecular formula C25H36N4O4 and a molecular weight of 456.59 g/mol. Its IUPAC name is 3-cyclohexyl-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)urea.
| Compound Name | 3-cyclohexyl-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)urea |
|---|---|
| PubChem CID | 1138164 |
| Molecular Formula | C25H36N4O4 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | 3-cyclohexyl-1-[(6-ethoxy-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-morpholin-4-ylethyl)urea |
| SMILES | CCOc1ccc2[nH]c(=O)c(CN(CCN3CCOCC3)C(=O)NC3CCCCC3)cc2c1 |
| InChI | InChI=1S/C25H36N4O4/c1-2-33-22-8-9-23-19(17-22)16-20(24(30)27-23)18-29(11-10-28-12-14-32-15-13-28)25(31)26-21-6-4-3-5-7-21/h8-9,16-17,21H,2-7,10-15,18H2,1H3,(H,26,31)(H,27,30) |
| InChIKey | AOEGHAGTGTUUJH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |