C24H34N4O2 — CID 3195105
3-cyclohexyl-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-pyrrolidin-1-ylethyl)urea (PubChem CID 3195105) has the molecular formula C24H34N4O2 and a molecular weight of 410.56 g/mol. Its IUPAC name is 3-cyclohexyl-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-pyrrolidin-1-ylethyl)urea.
| Compound Name | 3-cyclohexyl-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-pyrrolidin-1-ylethyl)urea |
|---|---|
| PubChem CID | 3195105 |
| Molecular Formula | C24H34N4O2 |
| Molecular Weight | 410.56 g/mol |
| Exact Mass | 410.27 |
| IUPAC Name | 3-cyclohexyl-1-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(2-pyrrolidin-1-ylethyl)urea |
| SMILES | Cc1ccc2cc(CN(CCN3CCCC3)C(=O)NC3CCCCC3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C24H34N4O2/c1-18-9-10-19-16-20(23(29)26-22(19)15-18)17-28(14-13-27-11-5-6-12-27)24(30)25-21-7-3-2-4-8-21/h9-10,15-16,21H,2-8,11-14,17H2,1H3,(H,25,30)(H,26,29) |
| InChIKey | ZJBRACOZHOVRID-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 68.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.56 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |