C18H23N3O2 — CID 110324549
1-cyclohexyl-3-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]urea (PubChem CID 110324549) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]urea.
| Compound Name | 1-cyclohexyl-3-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]urea |
|---|---|
| PubChem CID | 110324549 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 1-cyclohexyl-3-[(7-methyl-2-oxo-1H-quinolin-3-yl)methyl]urea |
| SMILES | Cc1ccc2cc(CNC(=O)NC3CCCCC3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C18H23N3O2/c1-12-7-8-13-10-14(17(22)21-16(13)9-12)11-19-18(23)20-15-5-3-2-4-6-15/h7-10,15H,2-6,11H2,1H3,(H,21,22)(H2,19,20,23) |
| InChIKey | PGYZDGFKNQXVBL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |