C20H27N3O2 — CID 110326400
1-cyclohexyl-3-[2-(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]urea (PubChem CID 110326400) has the molecular formula C20H27N3O2 and a molecular weight of 341.46 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]urea.
| Compound Name | 1-cyclohexyl-3-[2-(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 110326400 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 1-cyclohexyl-3-[2-(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)ethyl]urea |
| SMILES | Cc1cc(C)c2cc(CCNC(=O)NC3CCCCC3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C20H27N3O2/c1-13-10-14(2)17-12-15(19(24)23-18(17)11-13)8-9-21-20(25)22-16-6-4-3-5-7-16/h10-12,16H,3-9H2,1-2H3,(H,23,24)(H2,21,22,25) |
| InChIKey | CSRPOIBDGXFAIY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |