C22H31N3O2S — CID 3171200
3-cyclohexyl-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-hydroxypropyl)thiourea (PubChem CID 3171200) has the molecular formula C22H31N3O2S and a molecular weight of 401.58 g/mol. Its IUPAC name is 3-cyclohexyl-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-hydroxypropyl)thiourea.
| Compound Name | 3-cyclohexyl-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-hydroxypropyl)thiourea |
|---|---|
| PubChem CID | 3171200 |
| Molecular Formula | C22H31N3O2S |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 3-cyclohexyl-1-[(5,7-dimethyl-2-oxo-1H-quinolin-3-yl)methyl]-1-(3-hydroxypropyl)thiourea |
| SMILES | Cc1cc(C)c2cc(CN(CCCO)C(=S)NC3CCCCC3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C22H31N3O2S/c1-15-11-16(2)19-13-17(21(27)24-20(19)12-15)14-25(9-6-10-26)22(28)23-18-7-4-3-5-8-18/h11-13,18,26H,3-10,14H2,1-2H3,(H,23,28)(H,24,27) |
| InChIKey | AMXRCBRIVQACCN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|